C23H29NO4 — CID 9328142
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 9328142) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 9328142 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | CC(C)c1ccccc1NC(=O)COC(=O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29NO4/c1-16(2)19-8-6-7-9-20(19)24-21(25)14-28-22(26)15-27-18-12-10-17(11-13-18)23(3,4)5/h6-13,16H,14-15H2,1-5H3,(H,24,25) |
| InChIKey | IFUJXSHJOHMKRG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |