C18H13N5O4S — CID 2981233
N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-nitrobenzenesulfonamide (PubChem CID 2981233) has the molecular formula C18H13N5O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 2981233 |
| Molecular Formula | C18H13N5O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(3-imidazo[1,2-a]pyrimidin-2-ylphenyl)-4-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cccc(-c3cn4cccnc4n3)c2)cc1 |
| InChI | InChI=1S/C18H13N5O4S/c24-23(25)15-5-7-16(8-6-15)28(26,27)21-14-4-1-3-13(11-14)17-12-22-10-2-9-19-18(22)20-17/h1-12,21H |
| InChIKey | AJTYIZPKXFHYDN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|