C11H12N2O2 — CID 2981681
2-[(3,4-dimethylphenoxy)methyl]-1,3,4-oxadiazole (PubChem CID 2981681) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenoxy)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(3,4-dimethylphenoxy)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2981681 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-[(3,4-dimethylphenoxy)methyl]-1,3,4-oxadiazole |
| SMILES | Cc1ccc(OCc2nnco2)cc1C |
| InChI | InChI=1S/C11H12N2O2/c1-8-3-4-10(5-9(8)2)14-6-11-13-12-7-15-11/h3-5,7H,6H2,1-2H3 |
| InChIKey | KIDQVMMZFIAODS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |