C18H16F4N2O3S — CID 2984423
6-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2984423) has the molecular formula C18H16F4N2O3S and a molecular weight of 416.40 g/mol. Its IUPAC name is 6-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 6-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2984423 |
| Molecular Formula | C18H16F4N2O3S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 6-methyl-2-[(2,3,5,6-tetrafluoro-4-methoxybenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1c(F)c(F)c(C(=O)Nc2sc3c(c2C(N)=O)CCC(C)C3)c(F)c1F |
| InChI | InChI=1S/C18H16F4N2O3S/c1-6-3-4-7-8(5-6)28-18(9(7)16(23)25)24-17(26)10-11(19)13(21)15(27-2)14(22)12(10)20/h6H,3-5H2,1-2H3,(H2,23,25)(H,24,26) |
| InChIKey | DRBCBUUCIQNXIV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|