C23H21NO5 — CID 2987222
N-(3,4,5-trimethoxyphenyl)-9H-xanthene-9-carboxamide (PubChem CID 2987222) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-(3,4,5-trimethoxyphenyl)-9H-xanthene-9-carboxamide.
| Compound Name | N-(3,4,5-trimethoxyphenyl)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 2987222 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(3,4,5-trimethoxyphenyl)-9H-xanthene-9-carboxamide |
| SMILES | COc1cc(NC(=O)C2c3ccccc3Oc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C23H21NO5/c1-26-19-12-14(13-20(27-2)22(19)28-3)24-23(25)21-15-8-4-6-10-17(15)29-18-11-7-5-9-16(18)21/h4-13,21H,1-3H3,(H,24,25) |
| InChIKey | NYCIGRYMJLTDGY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |