C24H20N2O3 — CID 46568463
N-[3-(cyclopropanecarbonylamino)phenyl]-9H-xanthene-9-carboxamide (PubChem CID 46568463) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)phenyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)phenyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 46568463 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)phenyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2c3ccccc3Oc3ccccc32)c1)C1CC1 |
| InChI | InChI=1S/C24H20N2O3/c27-23(15-12-13-15)25-16-6-5-7-17(14-16)26-24(28)22-18-8-1-3-10-20(18)29-21-11-4-2-9-19(21)22/h1-11,14-15,22H,12-13H2,(H,25,27)(H,26,28) |
| InChIKey | ZDDMELMTGKKJCL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |