C17H15ClFN3O — CID 2989675
N-[1-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]formamide (PubChem CID 2989675) has the molecular formula C17H15ClFN3O and a molecular weight of 331.78 g/mol. Its IUPAC name is N-[1-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]formamide.
| Compound Name | N-[1-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]formamide |
|---|---|
| PubChem CID | 2989675 |
| Molecular Formula | C17H15ClFN3O |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[1-[1-[(2-chloro-6-fluorophenyl)methyl]benzimidazol-2-yl]ethyl]formamide |
| SMILES | CC(NC=O)c1nc2ccccc2n1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H15ClFN3O/c1-11(20-10-23)17-21-15-7-2-3-8-16(15)22(17)9-12-13(18)5-4-6-14(12)19/h2-8,10-11H,9H2,1H3,(H,20,23) |
| InChIKey | ARJOOZDHGXVDQN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|