C16H13F2N5O — CID 2990806
N-[(4-fluorophenyl)methyl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 2990806) has the molecular formula C16H13F2N5O and a molecular weight of 329.31 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 2990806 |
| Molecular Formula | C16H13F2N5O |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[5-(2-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2F)n1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13F2N5O/c17-12-7-5-11(6-8-12)9-19-15(24)10-23-21-16(20-22-23)13-3-1-2-4-14(13)18/h1-8H,9-10H2,(H,19,24) |
| InChIKey | IAAMCMBGNSYVJY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |