C20H17N5O — CID 75414451
N-(naphthalen-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 75414451) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is N-(naphthalen-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-(naphthalen-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 75414451 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(naphthalen-2-ylmethyl)-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H17N5O/c26-19(14-25-23-20(22-24-25)17-7-2-1-3-8-17)21-13-15-10-11-16-6-4-5-9-18(16)12-15/h1-12H,13-14H2,(H,21,26) |
| InChIKey | FDXXYMNPCGEXEW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |