C19H16N6O3S — CID 8505278
N'-naphthalen-2-ylsulfonyl-2-(5-phenyltetrazol-2-yl)acetohydrazide (PubChem CID 8505278) has the molecular formula C19H16N6O3S and a molecular weight of 408.44 g/mol. Its IUPAC name is N'-naphthalen-2-ylsulfonyl-2-(5-phenyltetrazol-2-yl)acetohydrazide.
| Compound Name | N'-naphthalen-2-ylsulfonyl-2-(5-phenyltetrazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 8505278 |
| Molecular Formula | C19H16N6O3S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N'-naphthalen-2-ylsulfonyl-2-(5-phenyltetrazol-2-yl)acetohydrazide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16N6O3S/c26-18(13-25-22-19(21-23-25)15-7-2-1-3-8-15)20-24-29(27,28)17-11-10-14-6-4-5-9-16(14)12-17/h1-12,24H,13H2,(H,20,26) |
| InChIKey | JCVJRDMIOWQOKK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|