C19H21N3O2S — CID 2992755
1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrazol-3-amine (PubChem CID 2992755) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrazol-3-amine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrazol-3-amine |
|---|---|
| PubChem CID | 2992755 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrazol-3-amine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)n2cc(-c3ccccc3)c(N)n2)cc1 |
| InChI | InChI=1S/C19H21N3O2S/c1-19(2,3)15-9-11-16(12-10-15)25(23,24)22-13-17(18(20)21-22)14-7-5-4-6-8-14/h4-13H,1-3H3,(H2,20,21) |
| InChIKey | IVUGJCNZRVNVJD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |