C6H6Cl2N2 — CID 29949
2,5-dichlorobenzene-1,4-diamine (PubChem CID 29949) has the molecular formula C6H6Cl2N2 and a molecular weight of 177.03 g/mol. Its IUPAC name is 2,5-dichlorobenzene-1,4-diamine.
| Compound Name | 2,5-dichlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 29949 |
| Molecular Formula | C6H6Cl2N2 |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | 2,5-dichlorobenzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(N)cc1Cl |
| InChI | InChI=1S/C6H6Cl2N2/c7-3-1-5(9)4(8)2-6(3)10/h1-2H,9-10H2 |
| InChIKey | QAYVHDDEMLNVMO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|