C18H15FN2O2 — CID 2995150
(3-fluorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate (PubChem CID 2995150) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate.
| Compound Name | (3-fluorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 2995150 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (3-fluorophenyl)methyl 2,3-dimethylquinoxaline-6-carboxylate |
| SMILES | Cc1nc2ccc(C(=O)OCc3cccc(F)c3)cc2nc1C |
| InChI | InChI=1S/C18H15FN2O2/c1-11-12(2)21-17-9-14(6-7-16(17)20-11)18(22)23-10-13-4-3-5-15(19)8-13/h3-9H,10H2,1-2H3 |
| InChIKey | HDGJLBYMHNFSAT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |