C16H21N5OS — CID 2995946
2-(1-methyltetrazol-5-yl)sulfanyl-1-(1,2,3,4,5,6,7,8-octahydrocarbazol-9-yl)ethanone (PubChem CID 2995946) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1-(1,2,3,4,5,6,7,8-octahydrocarbazol-9-yl)ethanone.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(1,2,3,4,5,6,7,8-octahydrocarbazol-9-yl)ethanone |
|---|---|
| PubChem CID | 2995946 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-(1,2,3,4,5,6,7,8-octahydrocarbazol-9-yl)ethanone |
| SMILES | Cn1nnnc1SCC(=O)n1c2c(c3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C16H21N5OS/c1-20-16(17-18-19-20)23-10-15(22)21-13-8-4-2-6-11(13)12-7-3-5-9-14(12)21/h2-10H2,1H3 |
| InChIKey | RWUVZNNMHKKHMM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |