C11H13N5OS — CID 2996570
4-amino-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylpyrimidine-5-carbonitrile (PubChem CID 2996570) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 4-amino-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 2996570 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-amino-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylpyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(SCC(=O)N2CCCC2)nc1N |
| InChI | InChI=1S/C11H13N5OS/c12-5-8-6-14-11(15-10(8)13)18-7-9(17)16-3-1-2-4-16/h6H,1-4,7H2,(H2,13,14,15) |
| InChIKey | WNDUZBXCZFTYQI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |