C8H8N4O2S — CID 654062
methyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate (PubChem CID 654062) has the molecular formula C8H8N4O2S and a molecular weight of 224.25 g/mol. Its IUPAC name is methyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate.
| Compound Name | methyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 654062 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | methyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C8H8N4O2S/c1-14-6(13)4-15-8-11-3-5(2-9)7(10)12-8/h3H,4H2,1H3,(H2,10,11,12) |
| InChIKey | DWPYIACWRIWTPI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |