C9H10N4O2S — CID 8809241
ethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate (PubChem CID 8809241) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is ethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate.
| Compound Name | ethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 8809241 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | ethyl 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSc1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C9H10N4O2S/c1-2-15-7(14)5-16-9-12-4-6(3-10)8(11)13-9/h4H,2,5H2,1H3,(H2,11,12,13) |
| InChIKey | YSLQQNBRVLBLCM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |