C11H16N4S — CID 651355
4-amino-2-hexylsulfanylpyrimidine-5-carbonitrile (PubChem CID 651355) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-amino-2-hexylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-hexylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 651355 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-amino-2-hexylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CCCCCCSc1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C11H16N4S/c1-2-3-4-5-6-16-11-14-8-9(7-12)10(13)15-11/h8H,2-6H2,1H3,(H2,13,14,15) |
| InChIKey | XJPGUJFEBPPBMM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|