C13H13Cl2N3O2S — CID 2997628
N-(2,3-dichlorophenyl)-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 2997628) has the molecular formula C13H13Cl2N3O2S and a molecular weight of 346.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 2997628 |
| Molecular Formula | C13H13Cl2N3O2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | C/N=C1/SC(CC(=O)Nc2cccc(Cl)c2Cl)C(=O)N1C |
| InChI | InChI=1S/C13H13Cl2N3O2S/c1-16-13-18(2)12(20)9(21-13)6-10(19)17-8-5-3-4-7(14)11(8)15/h3-5,9H,6H2,1-2H3,(H,17,19)/b16-13+ |
| InChIKey | LSVNCGUAGDAWBD-DTQAZKPQSA-N |
| XLogP | 2.88 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|