C23H19N5OS — CID 2997935
N-[2-[[1-(2-cyanoethyl)-3-phenylpyrazol-5-yl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 2997935) has the molecular formula C23H19N5OS and a molecular weight of 413.51 g/mol. Its IUPAC name is N-[2-[[1-(2-cyanoethyl)-3-phenylpyrazol-5-yl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[1-(2-cyanoethyl)-3-phenylpyrazol-5-yl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2997935 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[2-[[1-(2-cyanoethyl)-3-phenylpyrazol-5-yl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | N#CCCn1nc(-c2ccccc2)cc1Nc1ccccc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C23H19N5OS/c24-13-7-14-28-22(16-20(27-28)17-8-2-1-3-9-17)25-18-10-4-5-11-19(18)26-23(29)21-12-6-15-30-21/h1-6,8-12,15-16,25H,7,14H2,(H,26,29) |
| InChIKey | RLXHNPXLGYHYLL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |