C25H26N2O7S — CID 2999438
[2-[(1,1-Dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 2999438) has the molecular formula C25H26N2O7S and a molecular weight of 498.50 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [2-[(1,1-Dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 2999438 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | CCN(C1CCS(=O)(=O)C1)C(=O)COC(=O)C(CC2=CC=CC=C2)N3C(=O)C4=CC=CC=C4C3=O |
| InChI | InChI=1S/C25H26N2O7S/c1-2-26(18-12-13-35(32,33)16-18)22(28)15-34-25(31)21(14-17-8-4-3-5-9-17)27-23(29)19-10-6-7-11-20(19)24(27)30/h3-11,18,21H,2,12-16H2,1H3 |
| InChIKey | HOTLYXHKNGRNLG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 127.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | 914 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|