C16H22N2O4 — CID 2999801
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(dimethylamino)benzoate (PubChem CID 2999801) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(dimethylamino)benzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 2999801 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(dimethylamino)benzoate |
| SMILES | CN(C)c1cccc(C(=O)OCC(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-18(2)13-6-3-5-12(9-13)16(20)22-11-15(19)17-10-14-7-4-8-21-14/h3,5-6,9,14H,4,7-8,10-11H2,1-2H3,(H,17,19) |
| InChIKey | BHSQKEGZDGJORQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |