About 3-ethylhexane
3-ethylhexane (PubChem CID 12096) has the molecular formula C8H18
and a molecular weight of 114.23 g/mol. Its IUPAC name is 3-ethylhexane.
Molecular Properties
| Compound Name | 3-ethylhexane |
| PubChem CID | 12096 |
| Molecular Formula | C8H18 |
| Molecular Weight | 114.23 g/mol |
| Exact Mass | 114.14 |
| IUPAC Name | 3-ethylhexane |
| SMILES | CCCC(CC)CC |
| InChI | InChI=1S/C8H18/c1-4-7-8(5-2)6-3/h8H,4-7H2,1-3H3 |
| InChIKey | SFRKSDZMZHIISH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhexane?
The IUPAC name of 3-ethylhexane (CID 12096) is 3-ethylhexane.
What is the SMILES notation for 3-ethylhexane?
The canonical SMILES for 3-ethylhexane is CCCC(CC)CC.
What is the InChIKey of 3-ethylhexane?
The InChIKey is SFRKSDZMZHIISH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18/c1-4-7-8(5-2)6-3/h8H,4-7H2,1-3H3.
What are the key properties of 3-ethylhexane?
3-ethylhexane has a molecular weight of 114.23 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhexane is sourced from PubChem (CID 12096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).