C8H18 — CID 11269
2,3,4-trimethylpentane (PubChem CID 11269) has the molecular formula C8H18 and a molecular weight of 114.23 g/mol. Its IUPAC name is 2,3,4-trimethylpentane.
| Compound Name | 2,3,4-trimethylpentane |
|---|---|
| PubChem CID | 11269 |
| Molecular Formula | C8H18 |
| Molecular Weight | 114.23 g/mol |
| Exact Mass | 114.14 |
| IUPAC Name | 2,3,4-trimethylpentane |
| SMILES | CC(C)C(C)C(C)C |
| InChI | InChI=1S/C8H18/c1-6(2)8(5)7(3)4/h6-8H,1-5H3 |
| InChIKey | RLPGDEORIPLBNF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |