C9H20 — CID 13533
2,3,4-trimethylhexane (PubChem CID 13533) has the molecular formula C9H20 and a molecular weight of 128.26 g/mol. Its IUPAC name is 2,3,4-trimethylhexane.
| Compound Name | 2,3,4-trimethylhexane |
|---|---|
| PubChem CID | 13533 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | 2,3,4-trimethylhexane |
| SMILES | CCC(C)C(C)C(C)C |
| InChI | InChI=1S/C9H20/c1-6-8(4)9(5)7(2)3/h7-9H,6H2,1-5H3 |
| InChIKey | RUTNOQHQISEBGT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |