C22H27N3O7S — CID 3000173
[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate (PubChem CID 3000173) has the molecular formula C22H27N3O7S and a molecular weight of 477.54 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3000173 |
| Molecular Formula | C22H27N3O7S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)OCC(=O)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O7S/c1-3-25(4-2)33(29,30)18-9-7-17(8-10-18)22(28)32-16-20(26)23-11-13-24(14-12-23)21(27)19-6-5-15-31-19/h5-10,15H,3-4,11-14,16H2,1-2H3 |
| InChIKey | BPAGEQCGZBJBHS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |