C11H12BrN5S — CID 3002123
1-(5-bromo-2-pyridinyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea (PubChem CID 3002123) has the molecular formula C11H12BrN5S and a molecular weight of 326.22 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 3002123 |
| Molecular Formula | C11H12BrN5S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(1H-imidazol-5-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1cnc[nH]1)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H12BrN5S/c12-8-1-2-10(15-5-8)17-11(18)14-4-3-9-6-13-7-16-9/h1-2,5-7H,3-4H2,(H,13,16)(H2,14,15,17,18) |
| InChIKey | FRQSUVUISAXHFH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|