C13H10F2N2S2 — CID 3003022
4-[(3,4-difluorophenyl)methylsulfanyl]pyridine-2-carbothioamide (PubChem CID 3003022) has the molecular formula C13H10F2N2S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methylsulfanyl]pyridine-2-carbothioamide.
| Compound Name | 4-[(3,4-difluorophenyl)methylsulfanyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 3003022 |
| Molecular Formula | C13H10F2N2S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methylsulfanyl]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cc(SCc2ccc(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C13H10F2N2S2/c14-10-2-1-8(5-11(10)15)7-19-9-3-4-17-12(6-9)13(16)18/h1-6H,7H2,(H2,16,18) |
| InChIKey | KGFVGNSIAWQHSB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|