C14H14N4O4S — CID 3004864
(2Z)-N-(4-nitrophenyl)-3-oxo-2-[(2-sulfanylideneimidazolidin-1-yl)methylidene]butanamide (PubChem CID 3004864) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is (2Z)-N-(4-nitrophenyl)-3-oxo-2-[(2-sulfanylideneimidazolidin-1-yl)methylidene]butanamide.
| Compound Name | (2Z)-N-(4-nitrophenyl)-3-oxo-2-[(2-sulfanylideneimidazolidin-1-yl)methylidene]butanamide |
|---|---|
| PubChem CID | 3004864 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2Z)-N-(4-nitrophenyl)-3-oxo-2-[(2-sulfanylideneimidazolidin-1-yl)methylidene]butanamide |
| SMILES | CC(=O)/C(=C/N1CCNC1=S)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H14N4O4S/c1-9(19)12(8-17-7-6-15-14(17)23)13(20)16-10-2-4-11(5-3-10)18(21)22/h2-5,8H,6-7H2,1H3,(H,15,23)(H,16,20)/b12-8- |
| InChIKey | BCRQIVIVOPMCLM-WQLSENKSSA-N |
| XLogP | 1.20 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|