C19H18N2OS — CID 3004876
1-[(E)-3-oxo-2,3-diphenylprop-1-enyl]-3-prop-2-enylthiourea (PubChem CID 3004876) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-[(E)-3-oxo-2,3-diphenylprop-1-enyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[(E)-3-oxo-2,3-diphenylprop-1-enyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3004876 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-[(E)-3-oxo-2,3-diphenylprop-1-enyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)N/C=C(/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18N2OS/c1-2-13-20-19(23)21-14-17(15-9-5-3-6-10-15)18(22)16-11-7-4-8-12-16/h2-12,14H,1,13H2,(H2,20,21,23)/b17-14+ |
| InChIKey | PDABFQOYAKPCCY-SAPNQHFASA-N |
| XLogP | 3.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|