C10H17NO4S — CID 30054312
(2R)-4-methylsulfanyl-2-[[(2R)-oxolane-2-carbonyl]amino]butanoic acid (PubChem CID 30054312) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[[(2R)-oxolane-2-carbonyl]amino]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[[(2R)-oxolane-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 30054312 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[[(2R)-oxolane-2-carbonyl]amino]butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)[C@H]1CCCO1)C(=O)O |
| InChI | InChI=1S/C10H17NO4S/c1-16-6-4-7(10(13)14)11-9(12)8-3-2-5-15-8/h7-8H,2-6H2,1H3,(H,11,12)(H,13,14)/t7-,8-/m1/s1 |
| InChIKey | CCOFHLDHKHXIEX-HTQZYQBOSA-N |
| XLogP | 0.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |