C21H19NO3S2 — CID 30060515
[2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-thiophen-3-ylpropanoate (PubChem CID 30060515) has the molecular formula C21H19NO3S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-thiophen-3-ylpropanoate.
| Compound Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 30060515 |
| Molecular Formula | C21H19NO3S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [2-oxo-2-(2-phenylsulfanylanilino)ethyl] 3-thiophen-3-ylpropanoate |
| SMILES | O=C(COC(=O)CCc1ccsc1)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C21H19NO3S2/c23-20(14-25-21(24)11-10-16-12-13-26-15-16)22-18-8-4-5-9-19(18)27-17-6-2-1-3-7-17/h1-9,12-13,15H,10-11,14H2,(H,22,23) |
| InChIKey | BCSJDXMPVIRQNF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |