C18H23N3OS — CID 3006156
(11S)-10-(2,2-dimethylbut-3-enyl)-11-methyl-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde (PubChem CID 3006156) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is (11S)-10-(2,2-dimethylbut-3-enyl)-11-methyl-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde.
| Compound Name | (11S)-10-(2,2-dimethylbut-3-enyl)-11-methyl-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde |
|---|---|
| PubChem CID | 3006156 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (11S)-10-(2,2-dimethylbut-3-enyl)-11-methyl-2-sulfanylidene-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-7-carbaldehyde |
| SMILES | C=CC(C)(C)CN1Cc2c(C=O)ccc3[nH]c(=S)n(c23)C[C@@H]1C |
| InChI | InChI=1S/C18H23N3OS/c1-5-18(3,4)11-20-9-14-13(10-22)6-7-15-16(14)21(8-12(20)2)17(23)19-15/h5-7,10,12H,1,8-9,11H2,2-4H3,(H,19,23)/t12-/m0/s1 |
| InChIKey | OHGWAZTVVGEHKB-LBPRGKRZSA-N |
| XLogP | 3.93 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|