C8H14N4O — CID 3006276
2-tert-butyl-1H-imidazole-5-carbohydrazide (PubChem CID 3006276) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-tert-butyl-1H-imidazole-5-carbohydrazide.
| Compound Name | 2-tert-butyl-1H-imidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 3006276 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-tert-butyl-1H-imidazole-5-carbohydrazide |
| SMILES | CC(C)(C)c1ncc(C(=O)NN)[nH]1 |
| InChI | InChI=1S/C8H14N4O/c1-8(2,3)7-10-4-5(11-7)6(13)12-9/h4H,9H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | UPIFAEYHBJMRLZ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|