C27H28N2O — CID 3007943
6-cyclopentyl-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]-1H-benzimidazole (PubChem CID 3007943) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is 6-cyclopentyl-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]-1H-benzimidazole.
| Compound Name | 6-cyclopentyl-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 3007943 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 6-cyclopentyl-2-[4-[2-(4-methoxyphenyl)ethyl]phenyl]-1H-benzimidazole |
| SMILES | COc1ccc(CCc2ccc(-c3nc4ccc(C5CCCC5)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O/c1-30-24-15-10-20(11-16-24)7-6-19-8-12-22(13-9-19)27-28-25-17-14-23(18-26(25)29-27)21-4-2-3-5-21/h8-18,21H,2-7H2,1H3,(H,28,29) |
| InChIKey | HSLVIEMDUUREFW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |