C25H28N4 — CID 135876004
6-cyclohexyl-2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1H-benzimidazole (PubChem CID 135876004) has the molecular formula C25H28N4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 6-cyclohexyl-2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1H-benzimidazole.
| Compound Name | 6-cyclohexyl-2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 135876004 |
| Molecular Formula | C25H28N4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 6-cyclohexyl-2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-1H-benzimidazole |
| SMILES | Cc1ccc(Cn2nc(-c3nc4ccc(C5CCCCC5)cc4[nH]3)cc2C)cc1 |
| InChI | InChI=1S/C25H28N4/c1-17-8-10-19(11-9-17)16-29-18(2)14-24(28-29)25-26-22-13-12-21(15-23(22)27-25)20-6-4-3-5-7-20/h8-15,20H,3-7,16H2,1-2H3,(H,26,27) |
| InChIKey | USDCXGHIWXABQE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |