C25H22N4 — CID 135875994
2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-6-phenyl-1H-benzimidazole (PubChem CID 135875994) has the molecular formula C25H22N4 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-6-phenyl-1H-benzimidazole.
| Compound Name | 2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-6-phenyl-1H-benzimidazole |
|---|---|
| PubChem CID | 135875994 |
| Molecular Formula | C25H22N4 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-[5-methyl-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-6-phenyl-1H-benzimidazole |
| SMILES | Cc1ccc(Cn2nc(-c3nc4ccc(-c5ccccc5)cc4[nH]3)cc2C)cc1 |
| InChI | InChI=1S/C25H22N4/c1-17-8-10-19(11-9-17)16-29-18(2)14-24(28-29)25-26-22-13-12-21(15-23(22)27-25)20-6-4-3-5-7-20/h3-15H,16H2,1-2H3,(H,26,27) |
| InChIKey | ZEALQUAFHBOWCV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |