C25H29N3O — CID 73213157
N-(4-cyclohexylphenyl)-5-methyl-1-[(4-methylphenyl)methyl]pyrazole-3-carboxamide (PubChem CID 73213157) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)-5-methyl-1-[(4-methylphenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)-5-methyl-1-[(4-methylphenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 73213157 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(4-cyclohexylphenyl)-5-methyl-1-[(4-methylphenyl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(Cn2nc(C(=O)Nc3ccc(C4CCCCC4)cc3)cc2C)cc1 |
| InChI | InChI=1S/C25H29N3O/c1-18-8-10-20(11-9-18)17-28-19(2)16-24(27-28)25(29)26-23-14-12-22(13-15-23)21-6-4-3-5-7-21/h8-16,21H,3-7,17H2,1-2H3,(H,26,29) |
| InChIKey | IPGZTBHTOQYGCD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |