C18H23N3O3S — CID 78904587
N-(4-cyclohexylphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 78904587) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 78904587 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(4-cyclohexylphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NS(=O)(=O)c2ccc(C3CCCCC3)cc2)nn1C |
| InChI | InChI=1S/C18H23N3O3S/c1-13-12-17(19-21(13)2)18(22)20-25(23,24)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h8-12,14H,3-7H2,1-2H3,(H,20,22) |
| InChIKey | INBBFSVWLVQVJO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |