C14H17N3O5S — CID 18629743
N-(2,5-dimethoxyphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide (PubChem CID 18629743) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 18629743 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)sulfonyl-1,5-dimethylpyrazole-3-carboxamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC(=O)c2cc(C)n(C)n2)c1 |
| InChI | InChI=1S/C14H17N3O5S/c1-9-7-11(15-17(9)2)14(18)16-23(19,20)13-8-10(21-3)5-6-12(13)22-4/h5-8H,1-4H3,(H,16,18) |
| InChIKey | HMAZJTPKLYHRBT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |