C19H23NO5S — CID 78895807
N-(4-cyclohexylphenyl)sulfonyl-5-(methoxymethyl)furan-2-carboxamide (PubChem CID 78895807) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is N-(4-cyclohexylphenyl)sulfonyl-5-(methoxymethyl)furan-2-carboxamide.
| Compound Name | N-(4-cyclohexylphenyl)sulfonyl-5-(methoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78895807 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-(4-cyclohexylphenyl)sulfonyl-5-(methoxymethyl)furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)NS(=O)(=O)c2ccc(C3CCCCC3)cc2)o1 |
| InChI | InChI=1S/C19H23NO5S/c1-24-13-16-9-12-18(25-16)19(21)20-26(22,23)17-10-7-15(8-11-17)14-5-3-2-4-6-14/h7-12,14H,2-6,13H2,1H3,(H,20,21) |
| InChIKey | ASEKDVHBCUVAJW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |