C23H28N2O3S — CID 52685874
4-cyclohexyl-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 52685874) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-cyclohexyl-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 4-cyclohexyl-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 52685874 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-cyclohexyl-N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)NC2CC2)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c26-23(20-10-8-19(9-11-20)18-4-2-1-3-5-18)24-16-17-6-14-22(15-7-17)29(27,28)25-21-12-13-21/h6-11,14-15,18,21,25H,1-5,12-13,16H2,(H,24,26) |
| InChIKey | VRPZGCVFSPTBKV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |