C22H23N3O5S — CID 55847017
N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 55847017) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 55847017 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)NC2CC2)cc1)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c26-20-11-12-21(27)25(20)14-16-1-5-17(6-2-16)22(28)23-13-15-3-9-19(10-4-15)31(29,30)24-18-7-8-18/h1-6,9-10,18,24H,7-8,11-14H2,(H,23,28) |
| InChIKey | PKAKGHIHPPAZBR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|