C23H26ClN3 — CID 3008118
1-[[5-(2-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine (PubChem CID 3008118) has the molecular formula C23H26ClN3 and a molecular weight of 379.94 g/mol. Its IUPAC name is 1-[[5-(2-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine.
| Compound Name | 1-[[5-(2-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 3008118 |
| Molecular Formula | C23H26ClN3 |
| Molecular Weight | 379.94 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[[5-(2-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine |
| SMILES | Cc1c(CN2CCN(C)CC2)cc(-c2ccccc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C23H26ClN3/c1-18-19(17-26-14-12-25(2)13-15-26)16-23(21-10-6-7-11-22(21)24)27(18)20-8-4-3-5-9-20/h3-11,16H,12-15,17H2,1-2H3 |
| InChIKey | OSNXYDKTIBGYOP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|