C23H27NO4 — CID 3009564
1-O-benzyl 2-O-tert-butyl 2-benzylazetidine-1,2-dicarboxylate (PubChem CID 3009564) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl 2-benzylazetidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl 2-benzylazetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 3009564 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl 2-benzylazetidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(Cc2ccccc2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO4/c1-22(2,3)28-20(25)23(16-18-10-6-4-7-11-18)14-15-24(23)21(26)27-17-19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3 |
| InChIKey | QIZVCNXUAROOEI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |