C21H25F2N3O — CID 3009667
6-[(5R)-5-(2,4-difluorophenyl)-5-(imidazol-1-ylmethyl)oxolan-3-ylidene]-2-methylhexan-3-imine (PubChem CID 3009667) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 6-[(5R)-5-(2,4-difluorophenyl)-5-(imidazol-1-ylmethyl)oxolan-3-ylidene]-2-methylhexan-3-imine.
| Compound Name | 6-[(5R)-5-(2,4-difluorophenyl)-5-(imidazol-1-ylmethyl)oxolan-3-ylidene]-2-methylhexan-3-imine |
|---|---|
| PubChem CID | 3009667 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 6-[(5R)-5-(2,4-difluorophenyl)-5-(imidazol-1-ylmethyl)oxolan-3-ylidene]-2-methylhexan-3-imine |
| SMILES | [H]/N=C(/CCC=C1CO[C@@](Cn2ccnc2)(c2ccc(F)cc2F)C1)C(C)C |
| InChI | InChI=1S/C21H25F2N3O/c1-15(2)20(24)5-3-4-16-11-21(27-12-16,13-26-9-8-25-14-26)18-7-6-17(22)10-19(18)23/h4,6-10,14-15,24H,3,5,11-13H2,1-2H3/b16-4?,24-20-/t21-/m0/s1 |
| InChIKey | UUYJTDYFXYVZMD-XIIBCLNBSA-N |
| XLogP | 4.86 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|