About 1'-ethylspiro[adamantane-2,3'-pyrrolidine]
1'-ethylspiro[adamantane-2,3'-pyrrolidine] (PubChem CID 3009947) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 1'-ethylspiro[adamantane-2,3'-pyrrolidine].
Molecular Properties
| Compound Name | 1'-ethylspiro[adamantane-2,3'-pyrrolidine] |
| PubChem CID | 3009947 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1'-ethylspiro[adamantane-2,3'-pyrrolidine] |
| SMILES | CCN1CCC2(C1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C15H25N/c1-2-16-4-3-15(10-16)13-6-11-5-12(8-13)9-14(15)7-11/h11-14H,2-10H2,1H3 |
| InChIKey | NXFUQZXMMFOAMP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1'-ethylspiro[adamantane-2,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethylspiro[adamantane-2,3'-pyrrolidine]?
The IUPAC name of 1'-ethylspiro[adamantane-2,3'-pyrrolidine] (CID 3009947) is 1'-ethylspiro[adamantane-2,3'-pyrrolidine].
What is the SMILES notation for 1'-ethylspiro[adamantane-2,3'-pyrrolidine]?
The canonical SMILES for 1'-ethylspiro[adamantane-2,3'-pyrrolidine] is CCN1CCC2(C1)C1CC3CC(C1)CC2C3.
What is the InChIKey of 1'-ethylspiro[adamantane-2,3'-pyrrolidine]?
The InChIKey is NXFUQZXMMFOAMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-2-16-4-3-15(10-16)13-6-11-5-12(8-13)9-14(15)7-11/h11-14H,2-10H2,1H3.
What are the key properties of 1'-ethylspiro[adamantane-2,3'-pyrrolidine]?
1'-ethylspiro[adamantane-2,3'-pyrrolidine] has a molecular weight of 219.37 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethylspiro[adamantane-2,3'-pyrrolidine] is sourced from PubChem (CID 3009947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).