C10H7N3O2S2 — CID 3011120
8-nitrosulfanyl-4,5-dihydrobenzo[e][1,2,3]benzothiadiazole (PubChem CID 3011120) has the molecular formula C10H7N3O2S2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 8-nitrosulfanyl-4,5-dihydrobenzo[e][1,2,3]benzothiadiazole.
| Compound Name | 8-nitrosulfanyl-4,5-dihydrobenzo[e][1,2,3]benzothiadiazole |
|---|---|
| PubChem CID | 3011120 |
| Molecular Formula | C10H7N3O2S2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 8-nitrosulfanyl-4,5-dihydrobenzo[e][1,2,3]benzothiadiazole |
| SMILES | O=[N+]([O-])Sc1ccc2c(c1)-c1nnsc1CC2 |
| InChI | InChI=1S/C10H7N3O2S2/c14-13(15)17-7-3-1-6-2-4-9-10(8(6)5-7)11-12-16-9/h1,3,5H,2,4H2 |
| InChIKey | YPJOVLJTOWMMOD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|