C20H23NO3S — CID 3011805
5-[4-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-1-(5-methylthiophen-2-yl)pentan-1-one (PubChem CID 3011805) has the molecular formula C20H23NO3S and a molecular weight of 357.48 g/mol. Its IUPAC name is 5-[4-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-1-(5-methylthiophen-2-yl)pentan-1-one.
| Compound Name | 5-[4-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-1-(5-methylthiophen-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 3011805 |
| Molecular Formula | C20H23NO3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 5-[4-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]phenoxy]-1-(5-methylthiophen-2-yl)pentan-1-one |
| SMILES | Cc1ccc(C(=O)CCCCOc2ccc(C3=N[C@H](C)CO3)cc2)s1 |
| InChI | InChI=1S/C20H23NO3S/c1-14-13-24-20(21-14)16-7-9-17(10-8-16)23-12-4-3-5-18(22)19-11-6-15(2)25-19/h6-11,14H,3-5,12-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | NNXORJFGYVDZDR-CQSZACIVSA-N |
| XLogP | 4.65 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|