C22H27NO3S — CID 3011813
7-[4-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)heptan-1-one (PubChem CID 3011813) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is 7-[4-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)heptan-1-one.
| Compound Name | 7-[4-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)heptan-1-one |
|---|---|
| PubChem CID | 3011813 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 7-[4-(5-methyl-4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(5-methylthiophen-2-yl)heptan-1-one |
| SMILES | Cc1ccc(C(=O)CCCCCCOc2ccc(C3=NCC(C)O3)cc2)s1 |
| InChI | InChI=1S/C22H27NO3S/c1-16-15-23-22(26-16)18-9-11-19(12-10-18)25-14-6-4-3-5-7-20(24)21-13-8-17(2)27-21/h8-13,16H,3-7,14-15H2,1-2H3 |
| InChIKey | FBGWDZYDJRDRLR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|